C13H18N2O3 — CID 110185473
4-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)butanamide (PubChem CID 110185473) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)butanamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)butanamide |
|---|---|
| PubChem CID | 110185473 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)butanamide |
| SMILES | NC(=O)CCCNCC1COc2ccccc2O1 |
| InChI | InChI=1S/C13H18N2O3/c14-13(16)6-3-7-15-8-10-9-17-11-4-1-2-5-12(11)18-10/h1-2,4-5,10,15H,3,6-9H2,(H2,14,16) |
| InChIKey | YZTDMMHZXBPPKP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|