C21H23F3N2O3 — CID 70297166
5-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-N-[4-(trifluoromethyl)phenyl]pentanamide (PubChem CID 70297166) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 5-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-N-[4-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 5-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-N-[4-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 70297166 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 5-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-N-[4-(trifluoromethyl)phenyl]pentanamide |
| SMILES | O=C(CCCCNC[C@@H]1COc2ccccc2O1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F3N2O3/c22-21(23,24)15-8-10-16(11-9-15)26-20(27)7-3-4-12-25-13-17-14-28-18-5-1-2-6-19(18)29-17/h1-2,5-6,8-11,17,25H,3-4,7,12-14H2,(H,26,27)/t17-/m1/s1 |
| InChIKey | MXKRTZJQTHTYGR-QGZVFWFLSA-N |
| XLogP | 4.24 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|