C20H23NO5 — CID 13289725
4-(1,3-benzodioxol-5-yloxy)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)butan-1-amine (PubChem CID 13289725) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yloxy)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)butan-1-amine.
| Compound Name | 4-(1,3-benzodioxol-5-yloxy)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 13289725 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yloxy)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)butan-1-amine |
| SMILES | c1ccc2c(c1)OCC(CNCCCCOc1ccc3c(c1)OCO3)O2 |
| InChI | InChI=1S/C20H23NO5/c1-2-6-19-17(5-1)23-13-16(26-19)12-21-9-3-4-10-22-15-7-8-18-20(11-15)25-14-24-18/h1-2,5-8,11,16,21H,3-4,9-10,12-14H2 |
| InChIKey | XIURCTRZQONYIZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|