C16H23NO4 — CID 62449795
N-[[5-(1,3-benzodioxol-5-yloxymethyl)oxolan-2-yl]methyl]propan-1-amine (PubChem CID 62449795) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[[5-(1,3-benzodioxol-5-yloxymethyl)oxolan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(1,3-benzodioxol-5-yloxymethyl)oxolan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62449795 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[[5-(1,3-benzodioxol-5-yloxymethyl)oxolan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCC(COc2ccc3c(c2)OCO3)O1 |
| InChI | InChI=1S/C16H23NO4/c1-2-7-17-9-13-3-4-14(21-13)10-18-12-5-6-15-16(8-12)20-11-19-15/h5-6,8,13-14,17H,2-4,7,9-11H2,1H3 |
| InChIKey | ULXNMDNJGMHRTF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|