C16H18N2O3 — CID 62295833
N-[[2-(1,3-benzodioxol-5-yloxy)-4-pyridinyl]methyl]propan-1-amine (PubChem CID 62295833) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[[2-(1,3-benzodioxol-5-yloxy)-4-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(1,3-benzodioxol-5-yloxy)-4-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62295833 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[[2-(1,3-benzodioxol-5-yloxy)-4-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccnc(Oc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H18N2O3/c1-2-6-17-10-12-5-7-18-16(8-12)21-13-3-4-14-15(9-13)20-11-19-14/h3-5,7-9,17H,2,6,10-11H2,1H3 |
| InChIKey | LWCXWXMBSWPMCJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|