C16H19NO4 — CID 62450156
N-[[3-(1,3-benzodioxol-5-yloxymethyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 62450156) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[[3-(1,3-benzodioxol-5-yloxymethyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-(1,3-benzodioxol-5-yloxymethyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62450156 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[[3-(1,3-benzodioxol-5-yloxymethyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1occc1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H19NO4/c1-2-6-17-9-16-12(5-7-18-16)10-19-13-3-4-14-15(8-13)21-11-20-14/h3-5,7-8,17H,2,6,9-11H2,1H3 |
| InChIKey | WDCNAYQCDUWHGP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|