C11H12O4 — CID 123641845
6-(oxiran-2-ylmethoxy)-2,3-dihydro-1,4-benzodioxine (PubChem CID 123641845) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 6-(oxiran-2-ylmethoxy)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(oxiran-2-ylmethoxy)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 123641845 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 6-(oxiran-2-ylmethoxy)-2,3-dihydro-1,4-benzodioxine |
| SMILES | c1cc2c(cc1OCC1CO1)OCCO2 |
| InChI | InChI=1S/C11H12O4/c1-2-10-11(13-4-3-12-10)5-8(1)14-6-9-7-15-9/h1-2,5,9H,3-4,6-7H2 |
| InChIKey | UZWJGGXRZHXKMO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|