About 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile
2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile (PubChem CID 23850252) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile.
Analyze 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile?
The IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile (CID 23850252) is 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile.
What is the SMILES notation for 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile?
The canonical SMILES for 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile is N#CCOc1ccc2c(c1)OCCO2.
What is the InChIKey of 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile?
The InChIKey is FCCLZNUDRRSREH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c11-3-4-12-8-1-2-9-10(7-8)14-6-5-13-9/h1-2,7H,4-6H2.
What are the key properties of 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile?
2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile has a molecular weight of 191.19 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1,4-benzodioxin-6-yloxy)acetonitrile is sourced from PubChem (CID 23850252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).