C36H41NO5 — CID 67846544
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(cyclohexylmethylamino)ethoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate (PubChem CID 67846544) has the molecular formula C36H41NO5 and a molecular weight of 567.73 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(cyclohexylmethylamino)ethoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(cyclohexylmethylamino)ethoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 67846544 |
| Molecular Formula | C36H41NO5 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(cyclohexylmethylamino)ethoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate |
| SMILES | CCC(=C(c1ccc(OCCNCC2CCCCC2)cc1)c1ccc(OC(=O)C2CC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C36H41NO5/c1-2-32(29-14-19-33-34(22-29)41-24-40-33)35(27-12-17-31(18-13-27)42-36(38)28-8-9-28)26-10-15-30(16-11-26)39-21-20-37-23-25-6-4-3-5-7-25/h10-19,22,25,28,37H,2-9,20-21,23-24H2,1H3 |
| InChIKey | DWDXKONEVRRBDL-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|