C38H44N2O5 — CID 67846911
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-(1,3-dipyrrolidin-1-ylpropan-2-yloxy)phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate (PubChem CID 67846911) has the molecular formula C38H44N2O5 and a molecular weight of 608.78 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-(1,3-dipyrrolidin-1-ylpropan-2-yloxy)phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-(1,3-dipyrrolidin-1-ylpropan-2-yloxy)phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 67846911 |
| Molecular Formula | C38H44N2O5 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-(1,3-dipyrrolidin-1-ylpropan-2-yloxy)phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate |
| SMILES | CCC(=C(c1ccc(OC(=O)C2CC2)cc1)c1ccc(OC(CN2CCCC2)CN2CCCC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C38H44N2O5/c1-2-34(30-13-18-35-36(23-30)43-26-42-35)37(28-11-16-32(17-12-28)45-38(41)29-7-8-29)27-9-14-31(15-10-27)44-33(24-39-19-3-4-20-39)25-40-21-5-6-22-40/h9-18,23,29,33H,2-8,19-22,24-26H2,1H3 |
| InChIKey | FUEPABCYFDSYBV-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|