C34H37NO7 — CID 67846928
[4-[1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] cyclopropanecarboxylate (PubChem CID 67846928) has the molecular formula C34H37NO7 and a molecular weight of 571.67 g/mol. Its IUPAC name is [4-[1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 67846928 |
| Molecular Formula | C34H37NO7 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | [4-[1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] cyclopropanecarboxylate |
| SMILES | CCC(=C(c1ccc(OCC(CN(C)C)OC(C)=O)cc1)c1ccc(OC(=O)C2CC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C34H37NO7/c1-5-30(26-12-17-31-32(18-26)40-21-39-31)33(24-10-15-28(16-11-24)42-34(37)25-6-7-25)23-8-13-27(14-9-23)38-20-29(19-35(3)4)41-22(2)36/h8-18,25,29H,5-7,19-21H2,1-4H3 |
| InChIKey | QQPGDCQROBBOID-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|