C37H37NO7 — CID 67847250
[4-[(E)-1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] benzoate (PubChem CID 67847250) has the molecular formula C37H37NO7 and a molecular weight of 607.70 g/mol. Its IUPAC name is [4-[(E)-1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] benzoate.
| Compound Name | [4-[(E)-1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] benzoate |
|---|---|
| PubChem CID | 67847250 |
| Molecular Formula | C37H37NO7 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | [4-[(E)-1-[4-[2-acetyloxy-3-(dimethylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] benzoate |
| SMILES | CC/C(=C(/c1ccc(OCC(CN(C)C)OC(C)=O)cc1)c1ccc(OC(=O)c2ccccc2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C37H37NO7/c1-5-33(29-15-20-34-35(21-29)43-24-42-34)36(27-13-18-31(19-14-27)45-37(40)28-9-7-6-8-10-28)26-11-16-30(17-12-26)41-23-32(22-38(3)4)44-25(2)39/h6-21,32H,5,22-24H2,1-4H3/b36-33+ |
| InChIKey | ZEAPIQUGQUKSBT-PKUSAGTQSA-N |
| XLogP | 6.88 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|