C28H31NO5 — CID 67846690
4-[(E)-2-(1,3-benzodioxol-5-yl)-1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenol (PubChem CID 67846690) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzodioxol-5-yl)-1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenol.
| Compound Name | 4-[(E)-2-(1,3-benzodioxol-5-yl)-1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenol |
|---|---|
| PubChem CID | 67846690 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 4-[(E)-2-(1,3-benzodioxol-5-yl)-1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenol |
| SMILES | CC/C(=C(/c1ccc(O)cc1)c1ccc(OCC(O)CN(C)C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H31NO5/c1-4-25(21-9-14-26-27(15-21)34-18-33-26)28(19-5-10-22(30)11-6-19)20-7-12-24(13-8-20)32-17-23(31)16-29(2)3/h5-15,23,30-31H,4,16-18H2,1-3H3/b28-25+ |
| InChIKey | ZIYCNQSNTMVPJP-AZPGRJICSA-N |
| XLogP | 4.79 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|