C28H31NO4 — CID 67847028
4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(propan-2-ylamino)ethoxy]phenyl]but-1-enyl]phenol (PubChem CID 67847028) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(propan-2-ylamino)ethoxy]phenyl]but-1-enyl]phenol.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(propan-2-ylamino)ethoxy]phenyl]but-1-enyl]phenol |
|---|---|
| PubChem CID | 67847028 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(propan-2-ylamino)ethoxy]phenyl]but-1-enyl]phenol |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCNC(C)C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H31NO4/c1-4-25(22-9-14-26-27(17-22)33-18-32-26)28(20-5-10-23(30)11-6-20)21-7-12-24(13-8-21)31-16-15-29-19(2)3/h5-14,17,19,29-30H,4,15-16,18H2,1-3H3 |
| InChIKey | APLXFMOPYPBPNQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|