C30H33NO6 — CID 67847156
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] acetate (PubChem CID 67847156) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] acetate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 67847156 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] acetate |
| SMILES | CCNCC(O)COc1ccc(C(=C(CC)c2ccc3c(c2)OCO3)c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C30H33NO6/c1-4-27(23-10-15-28-29(16-23)36-19-35-28)30(22-8-13-26(14-9-22)37-20(3)32)21-6-11-25(12-7-21)34-18-24(33)17-31-5-2/h6-16,24,31,33H,4-5,17-19H2,1-3H3 |
| InChIKey | NFZVNHPSBZEVDC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|