C35H39NO6 — CID 67847181
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate (PubChem CID 67847181) has the molecular formula C35H39NO6 and a molecular weight of 569.70 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 67847181 |
| Molecular Formula | C35H39NO6 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenyl] cyclopropanecarboxylate |
| SMILES | CCC(=C(c1ccc(OCC(O)CNC2CCCC2)cc1)c1ccc(OC(=O)C2CC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H39NO6/c1-2-31(26-13-18-32-33(19-26)41-22-40-32)34(24-11-16-30(17-12-24)42-35(38)25-7-8-25)23-9-14-29(15-10-23)39-21-28(37)20-36-27-5-3-4-6-27/h9-19,25,27-28,36-37H,2-8,20-22H2,1H3 |
| InChIKey | MARZTCFBUUGYFB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|