C39H49NO7 — CID 67846627
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclohexylmethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 67846627) has the molecular formula C39H49NO7 and a molecular weight of 643.82 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclohexylmethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclohexylmethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67846627 |
| Molecular Formula | C39H49NO7 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.35 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[3-(cyclohexylmethylamino)-2-hydroxypropoxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CCC(=C(c1ccc(OCOC(=O)C(C)(C)C)cc1)c1ccc(OCC(O)CNCC2CCCCC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C39H49NO7/c1-5-34(30-15-20-35-36(21-30)46-26-45-35)37(29-13-18-33(19-14-29)44-25-47-38(42)39(2,3)4)28-11-16-32(17-12-28)43-24-31(41)23-40-22-27-9-7-6-8-10-27/h11-21,27,31,40-41H,5-10,22-26H2,1-4H3 |
| InChIKey | KVXNQKNNLKHYNG-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|