C33H39NO6 — CID 67846776
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 67846776) has the molecular formula C33H39NO6 and a molecular weight of 545.68 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67846776 |
| Molecular Formula | C33H39NO6 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(dimethylamino)ethoxy]phenyl]but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CCC(=C(c1ccc(OCCN(C)C)cc1)c1ccc(OCOC(=O)C(C)(C)C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C33H39NO6/c1-7-28(25-12-17-29-30(20-25)39-22-38-29)31(23-8-13-26(14-9-23)36-19-18-34(5)6)24-10-15-27(16-11-24)37-21-40-32(35)33(2,3)4/h8-17,20H,7,18-19,21-22H2,1-6H3 |
| InChIKey | PJVPFIPSYFQLHI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|