C32H37NO4 — CID 67846715
[4-[2,3-dihydroinden-1-ylidene-[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 67846715) has the molecular formula C32H37NO4 and a molecular weight of 499.65 g/mol. Its IUPAC name is [4-[2,3-dihydroinden-1-ylidene-[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[2,3-dihydroinden-1-ylidene-[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67846715 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | [4-[2,3-dihydroinden-1-ylidene-[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CN(C)CCOc1ccc(C(=C2CCc3ccccc32)c2ccc(OCOC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H37NO4/c1-32(2,3)31(34)37-22-36-27-17-12-25(13-18-27)30(29-19-14-23-8-6-7-9-28(23)29)24-10-15-26(16-11-24)35-21-20-33(4)5/h6-13,15-18H,14,19-22H2,1-5H3 |
| InChIKey | PFFQQEFAJDKUNC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|