C30H31NO4 — CID 67847233
[4-[2,3-dihydrochromen-4-ylidene-[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenyl] cyclopropanecarboxylate (PubChem CID 67847233) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is [4-[2,3-dihydrochromen-4-ylidene-[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[2,3-dihydrochromen-4-ylidene-[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 67847233 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | [4-[2,3-dihydrochromen-4-ylidene-[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenyl] cyclopropanecarboxylate |
| SMILES | CN(C)CCOc1ccc(C(=C2CCOc3ccccc32)c2ccc(OC(=O)C3CC3)cc2)cc1 |
| InChI | InChI=1S/C30H31NO4/c1-31(2)18-20-33-24-13-9-21(10-14-24)29(27-17-19-34-28-6-4-3-5-26(27)28)22-11-15-25(16-12-22)35-30(32)23-7-8-23/h3-6,9-16,23H,7-8,17-20H2,1-2H3 |
| InChIKey | XAENUKIJSPOWDN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|