C32H36O8 — CID 59429050
1-O-[4-(2-methoxyethoxy)phenyl] 4-O-[4-(2-phenylmethoxyethoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 59429050) has the molecular formula C32H36O8 and a molecular weight of 548.63 g/mol. Its IUPAC name is 1-O-[4-(2-methoxyethoxy)phenyl] 4-O-[4-(2-phenylmethoxyethoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-[4-(2-methoxyethoxy)phenyl] 4-O-[4-(2-phenylmethoxyethoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 59429050 |
| Molecular Formula | C32H36O8 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 1-O-[4-(2-methoxyethoxy)phenyl] 4-O-[4-(2-phenylmethoxyethoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | COCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OCCOCc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H36O8/c1-35-19-21-37-27-11-15-29(16-12-27)39-31(33)25-7-9-26(10-8-25)32(34)40-30-17-13-28(14-18-30)38-22-20-36-23-24-5-3-2-4-6-24/h2-6,11-18,25-26H,7-10,19-23H2,1H3 |
| InChIKey | SFHGIXUOUSKALJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|