About 2-phenylmethoxyethyl cyclopropanecarboxylate
2-phenylmethoxyethyl cyclopropanecarboxylate (PubChem CID 21489661) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-phenylmethoxyethyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | 2-phenylmethoxyethyl cyclopropanecarboxylate |
| PubChem CID | 21489661 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-phenylmethoxyethyl cyclopropanecarboxylate |
| SMILES | O=C(OCCOCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C13H16O3/c14-13(12-6-7-12)16-9-8-15-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| InChIKey | NWKWDRRMLJQSHE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylmethoxyethyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxyethyl cyclopropanecarboxylate?
The IUPAC name of 2-phenylmethoxyethyl cyclopropanecarboxylate (CID 21489661) is 2-phenylmethoxyethyl cyclopropanecarboxylate.
What is the SMILES notation for 2-phenylmethoxyethyl cyclopropanecarboxylate?
The canonical SMILES for 2-phenylmethoxyethyl cyclopropanecarboxylate is O=C(OCCOCc1ccccc1)C1CC1.
What is the InChIKey of 2-phenylmethoxyethyl cyclopropanecarboxylate?
The InChIKey is NWKWDRRMLJQSHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c14-13(12-6-7-12)16-9-8-15-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2.
What are the key properties of 2-phenylmethoxyethyl cyclopropanecarboxylate?
2-phenylmethoxyethyl cyclopropanecarboxylate has a molecular weight of 220.27 g/mol, XLogP of 2.16, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxyethyl cyclopropanecarboxylate is sourced from PubChem (CID 21489661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).