C17H24O4 — CID 59907113
methyl (1S)-3-(3-phenylmethoxypropoxy)cyclopentane-1-carboxylate (PubChem CID 59907113) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is methyl (1S)-3-(3-phenylmethoxypropoxy)cyclopentane-1-carboxylate.
| Compound Name | methyl (1S)-3-(3-phenylmethoxypropoxy)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 59907113 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | methyl (1S)-3-(3-phenylmethoxypropoxy)cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC(OCCCOCc2ccccc2)C1 |
| InChI | InChI=1S/C17H24O4/c1-19-17(18)15-8-9-16(12-15)21-11-5-10-20-13-14-6-3-2-4-7-14/h2-4,6-7,15-16H,5,8-13H2,1H3/t15-,16?/m0/s1 |
| InChIKey | AAZJOZMQPSPXJA-VYRBHSGPSA-N |
| XLogP | 2.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|