C16H22O3 — CID 129389048
cis-methyl (1R,3S)-3-(2-phenylethoxy)cyclohexane-1-carboxylate (PubChem CID 129389048) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is cis-methyl (1R,3S)-3-(2-phenylethoxy)cyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1R,3S)-3-(2-phenylethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 129389048 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | cis-methyl (1R,3S)-3-(2-phenylethoxy)cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC[C@H](OCCc2ccccc2)C1 |
| InChI | InChI=1S/C16H22O3/c1-18-16(17)14-8-5-9-15(12-14)19-11-10-13-6-3-2-4-7-13/h2-4,6-7,14-15H,5,8-12H2,1H3/t14-,15+/m1/s1 |
| InChIKey | UPYTVQSZLYJONJ-CABCVRRESA-N |
| XLogP | 2.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |