C10H18O4 — CID 69240437
cis-methyl (1R,3S)-3-(methoxymethoxy)cyclohexane-1-carboxylate (PubChem CID 69240437) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is cis-methyl (1R,3S)-3-(methoxymethoxy)cyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1R,3S)-3-(methoxymethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 69240437 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | cis-methyl (1R,3S)-3-(methoxymethoxy)cyclohexane-1-carboxylate |
| SMILES | COCO[C@H]1CCC[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C10H18O4/c1-12-7-14-9-5-3-4-8(6-9)10(11)13-2/h8-9H,3-7H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | BJNZGZRMUOLENY-BDAKNGLRSA-N |
| XLogP | 1.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|