C24H37N2O5+ — CID 59917306
[(1S)-1-cyclohexyl-2-[(4R)-2-methoxycarbonyl-4-(3-phenylmethoxypropoxy)pyrrolidin-1-yl]-2-oxoethyl]azanium (PubChem CID 59917306) has the molecular formula C24H37N2O5+ and a molecular weight of 433.57 g/mol. Its IUPAC name is [(1S)-1-cyclohexyl-2-[(4R)-2-methoxycarbonyl-4-(3-phenylmethoxypropoxy)pyrrolidin-1-yl]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-cyclohexyl-2-[(4R)-2-methoxycarbonyl-4-(3-phenylmethoxypropoxy)pyrrolidin-1-yl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 59917306 |
| Molecular Formula | C24H37N2O5+ |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | [(1S)-1-cyclohexyl-2-[(4R)-2-methoxycarbonyl-4-(3-phenylmethoxypropoxy)pyrrolidin-1-yl]-2-oxoethyl]azanium |
| SMILES | COC(=O)C1C[C@@H](OCCCOCc2ccccc2)CN1C(=O)[C@@H]([NH3+])C1CCCCC1 |
| InChI | InChI=1S/C24H36N2O5/c1-29-24(28)21-15-20(31-14-8-13-30-17-18-9-4-2-5-10-18)16-26(21)23(27)22(25)19-11-6-3-7-12-19/h2,4-5,9-10,19-22H,3,6-8,11-17,25H2,1H3/p+1/t20-,21?,22+/m1/s1 |
| InChIKey | IIXJYOZVILHYIB-QFMSAKRMSA-O |
| XLogP | 1.94 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|