About aminomethyl 2-phenylmethoxyethyl carbonate
aminomethyl 2-phenylmethoxyethyl carbonate (PubChem CID 134483943) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is aminomethyl 2-phenylmethoxyethyl carbonate.
Molecular Properties
| Compound Name | aminomethyl 2-phenylmethoxyethyl carbonate |
| PubChem CID | 134483943 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | aminomethyl 2-phenylmethoxyethyl carbonate |
| SMILES | NCOC(=O)OCCOCc1ccccc1 |
| InChI | InChI=1S/C11H15NO4/c12-9-16-11(13)15-7-6-14-8-10-4-2-1-3-5-10/h1-5H,6-9,12H2 |
| InChIKey | VPVAISANNWLHCG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze aminomethyl 2-phenylmethoxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminomethyl 2-phenylmethoxyethyl carbonate?
The IUPAC name of aminomethyl 2-phenylmethoxyethyl carbonate (CID 134483943) is aminomethyl 2-phenylmethoxyethyl carbonate.
What is the SMILES notation for aminomethyl 2-phenylmethoxyethyl carbonate?
The canonical SMILES for aminomethyl 2-phenylmethoxyethyl carbonate is NCOC(=O)OCCOCc1ccccc1.
What is the InChIKey of aminomethyl 2-phenylmethoxyethyl carbonate?
The InChIKey is VPVAISANNWLHCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c12-9-16-11(13)15-7-6-14-8-10-4-2-1-3-5-10/h1-5H,6-9,12H2.
What are the key properties of aminomethyl 2-phenylmethoxyethyl carbonate?
aminomethyl 2-phenylmethoxyethyl carbonate has a molecular weight of 225.24 g/mol, XLogP of 1.27, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aminomethyl 2-phenylmethoxyethyl carbonate is sourced from PubChem (CID 134483943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).