About benzyl 2-ethenoxyethyl carbonate
benzyl 2-ethenoxyethyl carbonate (PubChem CID 19813780) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is benzyl 2-ethenoxyethyl carbonate.
Molecular Properties
| Compound Name | benzyl 2-ethenoxyethyl carbonate |
| PubChem CID | 19813780 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | benzyl 2-ethenoxyethyl carbonate |
| SMILES | C=COCCOC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H14O4/c1-2-14-8-9-15-12(13)16-10-11-6-4-3-5-7-11/h2-7H,1,8-10H2 |
| InChIKey | LQDTYFPWIDWMIN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-ethenoxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-ethenoxyethyl carbonate?
The IUPAC name of benzyl 2-ethenoxyethyl carbonate (CID 19813780) is benzyl 2-ethenoxyethyl carbonate.
What is the SMILES notation for benzyl 2-ethenoxyethyl carbonate?
The canonical SMILES for benzyl 2-ethenoxyethyl carbonate is C=COCCOC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-ethenoxyethyl carbonate?
The InChIKey is LQDTYFPWIDWMIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-2-14-8-9-15-12(13)16-10-11-6-4-3-5-7-11/h2-7H,1,8-10H2.
What are the key properties of benzyl 2-ethenoxyethyl carbonate?
benzyl 2-ethenoxyethyl carbonate has a molecular weight of 222.24 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-ethenoxyethyl carbonate is sourced from PubChem (CID 19813780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).