About 2-phenylmethoxyethyl sulfanylmethyl carbonate
2-phenylmethoxyethyl sulfanylmethyl carbonate (PubChem CID 139402472) has the molecular formula C11H14O4S
and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-phenylmethoxyethyl sulfanylmethyl carbonate.
Molecular Properties
| Compound Name | 2-phenylmethoxyethyl sulfanylmethyl carbonate |
| PubChem CID | 139402472 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-phenylmethoxyethyl sulfanylmethyl carbonate |
| SMILES | O=C(OCS)OCCOCc1ccccc1 |
| InChI | InChI=1S/C11H14O4S/c12-11(15-9-16)14-7-6-13-8-10-4-2-1-3-5-10/h1-5,16H,6-9H2 |
| InChIKey | OZWZIZTYRKNJKE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylmethoxyethyl sulfanylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxyethyl sulfanylmethyl carbonate?
The IUPAC name of 2-phenylmethoxyethyl sulfanylmethyl carbonate (CID 139402472) is 2-phenylmethoxyethyl sulfanylmethyl carbonate.
What is the SMILES notation for 2-phenylmethoxyethyl sulfanylmethyl carbonate?
The canonical SMILES for 2-phenylmethoxyethyl sulfanylmethyl carbonate is O=C(OCS)OCCOCc1ccccc1.
What is the InChIKey of 2-phenylmethoxyethyl sulfanylmethyl carbonate?
The InChIKey is OZWZIZTYRKNJKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4S/c12-11(15-9-16)14-7-6-13-8-10-4-2-1-3-5-10/h1-5,16H,6-9H2.
What are the key properties of 2-phenylmethoxyethyl sulfanylmethyl carbonate?
2-phenylmethoxyethyl sulfanylmethyl carbonate has a molecular weight of 242.30 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxyethyl sulfanylmethyl carbonate is sourced from PubChem (CID 139402472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).