C26H32O4 — CID 71382772
bis(3-phenylpropyl) cyclohexane-1,4-dicarboxylate (PubChem CID 71382772) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is bis(3-phenylpropyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | bis(3-phenylpropyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 71382772 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | bis(3-phenylpropyl) cyclohexane-1,4-dicarboxylate |
| SMILES | O=C(OCCCc1ccccc1)C1CCC(C(=O)OCCCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H32O4/c27-25(29-19-7-13-21-9-3-1-4-10-21)23-15-17-24(18-16-23)26(28)30-20-8-14-22-11-5-2-6-12-22/h1-6,9-12,23-24H,7-8,13-20H2 |
| InChIKey | XONXSUPQRBOEIH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|