C15H19NO3 — CID 57351422
4-phenylbutyl (2S)-5-oxopyrrolidine-2-carboxylate (PubChem CID 57351422) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-phenylbutyl (2S)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | 4-phenylbutyl (2S)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57351422 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4-phenylbutyl (2S)-5-oxopyrrolidine-2-carboxylate |
| SMILES | O=C1CC[C@@H](C(=O)OCCCCc2ccccc2)N1 |
| InChI | InChI=1S/C15H19NO3/c17-14-10-9-13(16-14)15(18)19-11-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,16,17)/t13-/m0/s1 |
| InChIKey | LJTCEFYINQOTMA-ZDUSSCGKSA-N |
| XLogP | 1.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|