About undecyl (2S)-5-oxopyrrolidine-2-carboxylate
undecyl (2S)-5-oxopyrrolidine-2-carboxylate (PubChem CID 22840771) has the molecular formula C16H29NO3
and a molecular weight of 283.41 g/mol. Its IUPAC name is undecyl (2S)-5-oxopyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | undecyl (2S)-5-oxopyrrolidine-2-carboxylate |
| PubChem CID | 22840771 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | undecyl (2S)-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCCCCOC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C16H29NO3/c1-2-3-4-5-6-7-8-9-10-13-20-16(19)14-11-12-15(18)17-14/h14H,2-13H2,1H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | XWCIHBWSVCHGIS-AWEZNQCLSA-N |
| XLogP | 3.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecyl (2S)-5-oxopyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecyl (2S)-5-oxopyrrolidine-2-carboxylate?
The IUPAC name of undecyl (2S)-5-oxopyrrolidine-2-carboxylate (CID 22840771) is undecyl (2S)-5-oxopyrrolidine-2-carboxylate.
What is the SMILES notation for undecyl (2S)-5-oxopyrrolidine-2-carboxylate?
The canonical SMILES for undecyl (2S)-5-oxopyrrolidine-2-carboxylate is CCCCCCCCCCCOC(=O)[C@@H]1CCC(=O)N1.
What is the InChIKey of undecyl (2S)-5-oxopyrrolidine-2-carboxylate?
The InChIKey is XWCIHBWSVCHGIS-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H29NO3/c1-2-3-4-5-6-7-8-9-10-13-20-16(19)14-11-12-15(18)17-14/h14H,2-13H2,1H3,(H,17,18)/t14-/m0/s1.
What are the key properties of undecyl (2S)-5-oxopyrrolidine-2-carboxylate?
undecyl (2S)-5-oxopyrrolidine-2-carboxylate has a molecular weight of 283.41 g/mol, XLogP of 3.34, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for undecyl (2S)-5-oxopyrrolidine-2-carboxylate is sourced from PubChem (CID 22840771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).