C17H29NO3 — CID 54310803
dodec-4-enyl 5-oxopyrrolidine-2-carboxylate (PubChem CID 54310803) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is dodec-4-enyl 5-oxopyrrolidine-2-carboxylate.
| Compound Name | dodec-4-enyl 5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54310803 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | dodec-4-enyl 5-oxopyrrolidine-2-carboxylate |
| SMILES | CCCCCCCC=CCCCOC(=O)C1CCC(=O)N1 |
| InChI | InChI=1S/C17H29NO3/c1-2-3-4-5-6-7-8-9-10-11-14-21-17(20)15-12-13-16(19)18-15/h8-9,15H,2-7,10-14H2,1H3,(H,18,19) |
| InChIKey | SKSVNVCCHDTRAX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|