C31H42NO6+ — CID 22616191
3-phenylpropyl 1,1-bis(2-cyclohexyl-2-oxoacetyl)piperidin-1-ium-2-carboxylate (PubChem CID 22616191) has the molecular formula C31H42NO6+ and a molecular weight of 524.68 g/mol. Its IUPAC name is 3-phenylpropyl 1,1-bis(2-cyclohexyl-2-oxoacetyl)piperidin-1-ium-2-carboxylate.
| Compound Name | 3-phenylpropyl 1,1-bis(2-cyclohexyl-2-oxoacetyl)piperidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 22616191 |
| Molecular Formula | C31H42NO6+ |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | 3-phenylpropyl 1,1-bis(2-cyclohexyl-2-oxoacetyl)piperidin-1-ium-2-carboxylate |
| SMILES | O=C(C(=O)[N+]1(C(=O)C(=O)C2CCCCC2)CCCCC1C(=O)OCCCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C31H42NO6/c33-27(24-16-6-2-7-17-24)29(35)32(30(36)28(34)25-18-8-3-9-19-25)21-11-10-20-26(32)31(37)38-22-12-15-23-13-4-1-5-14-23/h1,4-5,13-14,24-26H,2-3,6-12,15-22H2/q+1 |
| InChIKey | ZZVAIJFSHWMYHH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|