C20H26O4 — CID 91710137
4-O-(cyclohexylmethyl) 1-O-(3-phenylpropyl) (E)-but-2-enedioate (PubChem CID 91710137) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 4-O-(cyclohexylmethyl) 1-O-(3-phenylpropyl) (E)-but-2-enedioate.
| Compound Name | 4-O-(cyclohexylmethyl) 1-O-(3-phenylpropyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91710137 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-O-(cyclohexylmethyl) 1-O-(3-phenylpropyl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OCC1CCCCC1)OCCCc1ccccc1 |
| InChI | InChI=1S/C20H26O4/c21-19(23-15-7-12-17-8-3-1-4-9-17)13-14-20(22)24-16-18-10-5-2-6-11-18/h1,3-4,8-9,13-14,18H,2,5-7,10-12,15-16H2/b14-13+ |
| InChIKey | XUCLDZYJGXOFLW-BUHFOSPRSA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|