C16H20O8 — CID 91371568
4-[[4-(3-carboxyprop-2-enoyloxymethyl)cyclohexyl]methoxy]-4-oxobut-2-enoic acid (PubChem CID 91371568) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is 4-[[4-(3-carboxyprop-2-enoyloxymethyl)cyclohexyl]methoxy]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[4-(3-carboxyprop-2-enoyloxymethyl)cyclohexyl]methoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 91371568 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-[[4-(3-carboxyprop-2-enoyloxymethyl)cyclohexyl]methoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)OCC1CCC(COC(=O)C=CC(=O)O)CC1 |
| InChI | InChI=1S/C16H20O8/c17-13(18)5-7-15(21)23-9-11-1-2-12(4-3-11)10-24-16(22)8-6-14(19)20/h5-8,11-12H,1-4,9-10H2,(H,17,18)(H,19,20) |
| InChIKey | JJPFOVPWPDXODJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|