About 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate
4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate (PubChem CID 91698443) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate |
| PubChem CID | 91698443 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate |
| SMILES | CC(C)CCCOC(=O)/C=C/C(=O)OCC1CCCC1 |
| InChI | InChI=1S/C16H26O4/c1-13(2)6-5-11-19-15(17)9-10-16(18)20-12-14-7-3-4-8-14/h9-10,13-14H,3-8,11-12H2,1-2H3/b10-9+ |
| InChIKey | AHJRJRCJWGLQGT-MDZDMXLPSA-N |
| XLogP | 3.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate?
The IUPAC name of 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate (CID 91698443) is 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate.
What is the SMILES notation for 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate?
The canonical SMILES for 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate is CC(C)CCCOC(=O)/C=C/C(=O)OCC1CCCC1.
What is the InChIKey of 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate?
The InChIKey is AHJRJRCJWGLQGT-MDZDMXLPSA-N. The full InChI is InChI=1S/C16H26O4/c1-13(2)6-5-11-19-15(17)9-10-16(18)20-12-14-7-3-4-8-14/h9-10,13-14H,3-8,11-12H2,1-2H3/b10-9+.
What are the key properties of 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate?
4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate has a molecular weight of 282.38 g/mol, XLogP of 3.26, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(cyclopentylmethyl) 1-O-(4-methylpentyl) (E)-but-2-enedioate is sourced from PubChem (CID 91698443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).