C17H28O4 — CID 172565478
(E)-4-oxo-4-[4-(4-propylcyclohexyl)butoxy]but-2-enoic acid (PubChem CID 172565478) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-(4-propylcyclohexyl)butoxy]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-(4-propylcyclohexyl)butoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 172565478 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (E)-4-oxo-4-[4-(4-propylcyclohexyl)butoxy]but-2-enoic acid |
| SMILES | CCCC1CCC(CCCCOC(=O)/C=C/C(=O)O)CC1 |
| InChI | InChI=1S/C17H28O4/c1-2-5-14-7-9-15(10-8-14)6-3-4-13-21-17(20)12-11-16(18)19/h11-12,14-15H,2-10,13H2,1H3,(H,18,19)/b12-11+ |
| InChIKey | ZAAVPDITATYOIS-VAWYXSNFSA-N |
| XLogP | 3.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|