C19H32O4 — CID 172565548
(E)-4-oxo-4-[2-(4-propylcyclohexyl)hexan-2-yloxy]but-2-enoic acid (PubChem CID 172565548) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (E)-4-oxo-4-[2-(4-propylcyclohexyl)hexan-2-yloxy]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[2-(4-propylcyclohexyl)hexan-2-yloxy]but-2-enoic acid |
|---|---|
| PubChem CID | 172565548 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (E)-4-oxo-4-[2-(4-propylcyclohexyl)hexan-2-yloxy]but-2-enoic acid |
| SMILES | CCCCC(C)(OC(=O)/C=C/C(=O)O)C1CCC(CCC)CC1 |
| InChI | InChI=1S/C19H32O4/c1-4-6-14-19(3,23-18(22)13-12-17(20)21)16-10-8-15(7-5-2)9-11-16/h12-13,15-16H,4-11,14H2,1-3H3,(H,20,21)/b13-12+ |
| InChIKey | XWGRTEUQGZEZOY-OUKQBFOZSA-N |
| XLogP | 4.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|