C16H24O4 — CID 172565423
(E)-4-oxo-4-[1-(4-propylcyclohexyl)cyclopropyl]oxybut-2-enoic acid (PubChem CID 172565423) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (E)-4-oxo-4-[1-(4-propylcyclohexyl)cyclopropyl]oxybut-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[1-(4-propylcyclohexyl)cyclopropyl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 172565423 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (E)-4-oxo-4-[1-(4-propylcyclohexyl)cyclopropyl]oxybut-2-enoic acid |
| SMILES | CCCC1CCC(C2(OC(=O)/C=C/C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C16H24O4/c1-2-3-12-4-6-13(7-5-12)16(10-11-16)20-15(19)9-8-14(17)18/h8-9,12-13H,2-7,10-11H2,1H3,(H,17,18)/b9-8+ |
| InChIKey | BPTTXKKNQSLVLS-CMDGGOBGSA-N |
| XLogP | 3.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|