C20H32O4 — CID 172565499
(E)-4-oxo-4-[1-(4-pentan-2-ylcyclohexyl)cyclopentyl]oxybut-2-enoic acid (PubChem CID 172565499) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (E)-4-oxo-4-[1-(4-pentan-2-ylcyclohexyl)cyclopentyl]oxybut-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[1-(4-pentan-2-ylcyclohexyl)cyclopentyl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 172565499 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (E)-4-oxo-4-[1-(4-pentan-2-ylcyclohexyl)cyclopentyl]oxybut-2-enoic acid |
| SMILES | CCCC(C)C1CCC(C2(OC(=O)/C=C/C(=O)O)CCCC2)CC1 |
| InChI | InChI=1S/C20H32O4/c1-3-6-15(2)16-7-9-17(10-8-16)20(13-4-5-14-20)24-19(23)12-11-18(21)22/h11-12,15-17H,3-10,13-14H2,1-2H3,(H,21,22)/b12-11+ |
| InChIKey | HWPNJSUONSQRCC-VAWYXSNFSA-N |
| XLogP | 4.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|