About (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate
(1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate (PubChem CID 158761805) has the molecular formula C17H29FO2
and a molecular weight of 284.41 g/mol. Its IUPAC name is (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate.
Molecular Properties
| Compound Name | (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate |
| PubChem CID | 158761805 |
| Molecular Formula | C17H29FO2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate |
| SMILES | CCC[C@@H](F)C(=O)OC1(C2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C17H29FO2/c1-2-9-15(18)16(19)20-17(12-7-4-8-13-17)14-10-5-3-6-11-14/h14-15H,2-13H2,1H3/t15-/m1/s1 |
| InChIKey | IOTOFTJVSNGAJY-OAHLLOKOSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate?
The IUPAC name of (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate (CID 158761805) is (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate.
What is the SMILES notation for (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate?
The canonical SMILES for (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate is CCC[C@@H](F)C(=O)OC1(C2CCCCC2)CCCCC1.
What is the InChIKey of (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate?
The InChIKey is IOTOFTJVSNGAJY-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H29FO2/c1-2-9-15(18)16(19)20-17(12-7-4-8-13-17)14-10-5-3-6-11-14/h14-15H,2-13H2,1H3/t15-/m1/s1.
What are the key properties of (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate?
(1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate has a molecular weight of 284.41 g/mol, XLogP of 4.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexylcyclohexyl) (2R)-2-fluoropentanoate is sourced from PubChem (CID 158761805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).