C30H52O4 — CID 91140508
(1-cyclohexylcyclopentyl) 2,2-dimethylbutanoate;(1-ethylcyclopent-2-en-1-yl) 2,2-dimethylbutanoate (PubChem CID 91140508) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is (1-cyclohexylcyclopentyl) 2,2-dimethylbutanoate;(1-ethylcyclopent-2-en-1-yl) 2,2-dimethylbutanoate.
| Compound Name | (1-cyclohexylcyclopentyl) 2,2-dimethylbutanoate;(1-ethylcyclopent-2-en-1-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91140508 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | (1-cyclohexylcyclopentyl) 2,2-dimethylbutanoate;(1-ethylcyclopent-2-en-1-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C2CCCCC2)CCCC1.CCC1(OC(=O)C(C)(C)CC)C=CCC1 |
| InChI | InChI=1S/C17H30O2.C13H22O2/c1-4-16(2,3)15(18)19-17(12-8-9-13-17)14-10-6-5-7-11-14;1-5-12(3,4)11(14)15-13(6-2)9-7-8-10-13/h14H,4-13H2,1-3H3;7,9H,5-6,8,10H2,1-4H3 |
| InChIKey | IBFGPSNACZXACR-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|