C17H36O2 — CID 162048791
(1-tert-butylcyclopentyl) 2,2-dimethylbutanoate;methane (PubChem CID 162048791) has the molecular formula C17H36O2 and a molecular weight of 272.47 g/mol. Its IUPAC name is (1-tert-butylcyclopentyl) 2,2-dimethylbutanoate;methane.
| Compound Name | (1-tert-butylcyclopentyl) 2,2-dimethylbutanoate;methane |
|---|---|
| PubChem CID | 162048791 |
| Molecular Formula | C17H36O2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.27 |
| IUPAC Name | (1-tert-butylcyclopentyl) 2,2-dimethylbutanoate;methane |
| SMILES | C.C.CCC(C)(C)C(=O)OC1(C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C15H28O2.2CH4/c1-7-14(5,6)12(16)17-15(13(2,3)4)10-8-9-11-15;;/h7-11H2,1-6H3;2*1H4 |
| InChIKey | YYGPSZHFXDGFKW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |