C16H30O2 — CID 58776795
(1-tert-butylcyclohexyl) 2,2-dimethylbutanoate (PubChem CID 58776795) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (1-tert-butylcyclohexyl) 2,2-dimethylbutanoate.
| Compound Name | (1-tert-butylcyclohexyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58776795 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (1-tert-butylcyclohexyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C16H30O2/c1-7-15(5,6)13(17)18-16(14(2,3)4)11-9-8-10-12-16/h7-12H2,1-6H3 |
| InChIKey | IICJSIFUIHUMJO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |