C34H56O8 — CID 91429891
2,2-dimethylbutanoic acid;(1-ethylcyclohex-2-en-1-yl) 2,2-dimethylbutanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate (PubChem CID 91429891) has the molecular formula C34H56O8 and a molecular weight of 592.81 g/mol. Its IUPAC name is 2,2-dimethylbutanoic acid;(1-ethylcyclohex-2-en-1-yl) 2,2-dimethylbutanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate.
| Compound Name | 2,2-dimethylbutanoic acid;(1-ethylcyclohex-2-en-1-yl) 2,2-dimethylbutanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91429891 |
| Molecular Formula | C34H56O8 |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | 2,2-dimethylbutanoic acid;(1-ethylcyclohex-2-en-1-yl) 2,2-dimethylbutanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O.CCC(C)(C)C(=O)OC1C2CC3C(=O)OC1C3C2.CCC1(OC(=O)C(C)(C)CC)C=CCCC1 |
| InChI | InChI=1S/C14H20O4.C14H24O2.C6H12O2/c1-4-14(2,3)13(16)18-10-7-5-8-9(6-7)12(15)17-11(8)10;1-5-13(3,4)12(15)16-14(6-2)10-8-7-9-11-14;1-4-6(2,3)5(7)8/h7-11H,4-6H2,1-3H3;8,10H,5-7,9,11H2,1-4H3;4H2,1-3H3,(H,7,8) |
| InChIKey | ULXVETCTXFTVMB-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|