C23H36O6 — CID 58887153
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 9-(2,2-dimethylbutanoyloxy)nonanoate (PubChem CID 58887153) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 9-(2,2-dimethylbutanoyloxy)nonanoate.
| Compound Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 9-(2,2-dimethylbutanoyloxy)nonanoate |
|---|---|
| PubChem CID | 58887153 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 9-(2,2-dimethylbutanoyloxy)nonanoate |
| SMILES | CCC(C)(C)C(=O)OCCCCCCCCC(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C23H36O6/c1-4-23(2,3)22(26)27-12-10-8-6-5-7-9-11-18(24)28-19-15-13-16-17(14-15)21(25)29-20(16)19/h15-17,19-20H,4-14H2,1-3H3 |
| InChIKey | LFOMSUQAFVLEBC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|