C12H14I2O4 — CID 153151173
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2,3-diiodo-2-methylpropanoate (PubChem CID 153151173) has the molecular formula C12H14I2O4 and a molecular weight of 476.05 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2,3-diiodo-2-methylpropanoate.
| Compound Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2,3-diiodo-2-methylpropanoate |
|---|---|
| PubChem CID | 153151173 |
| Molecular Formula | C12H14I2O4 |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.90 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2,3-diiodo-2-methylpropanoate |
| SMILES | CC(I)(CI)C(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C12H14I2O4/c1-12(14,4-13)11(16)18-8-5-2-6-7(3-5)10(15)17-9(6)8/h5-9H,2-4H2,1H3 |
| InChIKey | WAMWKFCLSGXCAD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|