C16H28O2 — CID 159689177
(2-methyl-2-bicyclo[6.1.0]nonanyl) 2,2-dimethylbutanoate (PubChem CID 159689177) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (2-methyl-2-bicyclo[6.1.0]nonanyl) 2,2-dimethylbutanoate.
| Compound Name | (2-methyl-2-bicyclo[6.1.0]nonanyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159689177 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (2-methyl-2-bicyclo[6.1.0]nonanyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CCCCCC2CC21 |
| InChI | InChI=1S/C16H28O2/c1-5-15(2,3)14(17)18-16(4)10-8-6-7-9-12-11-13(12)16/h12-13H,5-11H2,1-4H3 |
| InChIKey | MCTZZZPMKXEEOQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |