C22H36O2 — CID 67473170
(2-cyclohexyl-2-adamantyl) 2,2-dimethylbutanoate (PubChem CID 67473170) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (2-cyclohexyl-2-adamantyl) 2,2-dimethylbutanoate.
| Compound Name | (2-cyclohexyl-2-adamantyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 67473170 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (2-cyclohexyl-2-adamantyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C2CCCCC2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H36O2/c1-4-21(2,3)20(23)24-22(17-8-6-5-7-9-17)18-11-15-10-16(13-18)14-19(22)12-15/h15-19H,4-14H2,1-3H3 |
| InChIKey | RHFRNGLMACZNAY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |